C22H28N2O5S2 — CID 42744205
N-butyl-2-thiophen-2-yl-3-(3,4,5-trimethoxybenzoyl)-1,3-thiazolidine-4-carboxamide (PubChem CID 42744205) has the molecular formula C22H28N2O5S2 and a molecular weight of 464.61 g/mol. Its IUPAC name is N-butyl-2-thiophen-2-yl-3-(3,4,5-trimethoxybenzoyl)-1,3-thiazolidine-4-carboxamide.
| Compound Name | N-butyl-2-thiophen-2-yl-3-(3,4,5-trimethoxybenzoyl)-1,3-thiazolidine-4-carboxamide |
|---|---|
| PubChem CID | 42744205 |
| Molecular Formula | C22H28N2O5S2 |
| Molecular Weight | 464.61 g/mol |
| Exact Mass | 464.14 |
| IUPAC Name | N-butyl-2-thiophen-2-yl-3-(3,4,5-trimethoxybenzoyl)-1,3-thiazolidine-4-carboxamide |
| SMILES | CCCCNC(=O)C1CSC(c2cccs2)N1C(=O)c1cc(OC)c(OC)c(OC)c1 |
| InChI | InChI=1S/C22H28N2O5S2/c1-5-6-9-23-20(25)15-13-31-22(18-8-7-10-30-18)24(15)21(26)14-11-16(27-2)19(29-4)17(12-14)28-3/h7-8,10-12,15,22H,5-6,9,13H2,1-4H3,(H,23,25) |
| InChIKey | QIKOILXQGLEJCW-UHFFFAOYSA-N |
| XLogP | 3.95 |
| TPSA | 77.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 464.61 |
| LogP ≤ 5 | 3.95 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|