C19H21ClN2O2S2 — CID 7498305
(2R,4S)-N-butyl-3-(2-chlorobenzoyl)-2-thiophen-2-yl-1,3-thiazolidine-4-carboxamide (PubChem CID 7498305) has the molecular formula C19H21ClN2O2S2 and a molecular weight of 408.98 g/mol. Its IUPAC name is (2R,4S)-N-butyl-3-(2-chlorobenzoyl)-2-thiophen-2-yl-1,3-thiazolidine-4-carboxamide.
| Compound Name | (2R,4S)-N-butyl-3-(2-chlorobenzoyl)-2-thiophen-2-yl-1,3-thiazolidine-4-carboxamide |
|---|---|
| PubChem CID | 7498305 |
| Molecular Formula | C19H21ClN2O2S2 |
| Molecular Weight | 408.98 g/mol |
| Exact Mass | 408.07 |
| IUPAC Name | (2R,4S)-N-butyl-3-(2-chlorobenzoyl)-2-thiophen-2-yl-1,3-thiazolidine-4-carboxamide |
| SMILES | CCCCNC(=O)[C@H]1CS[C@H](c2cccs2)N1C(=O)c1ccccc1Cl |
| InChI | InChI=1S/C19H21ClN2O2S2/c1-2-3-10-21-17(23)15-12-26-19(16-9-6-11-25-16)22(15)18(24)13-7-4-5-8-14(13)20/h4-9,11,15,19H,2-3,10,12H2,1H3,(H,21,23)/t15-,19-/m1/s1 |
| InChIKey | ONALWDBMSSVRBO-DNVCBOLYSA-N |
| XLogP | 4.57 |
| TPSA | 49.41 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 408.98 |
| LogP ≤ 5 | 4.57 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|