C23H26Cl2N2O2S — CID 42744012
2-(3,4-dichlorophenyl)-3-(4-methylbenzoyl)-N-pentyl-1,3-thiazolidine-4-carboxamide (PubChem CID 42744012) has the molecular formula C23H26Cl2N2O2S and a molecular weight of 465.45 g/mol. Its IUPAC name is 2-(3,4-dichlorophenyl)-3-(4-methylbenzoyl)-N-pentyl-1,3-thiazolidine-4-carboxamide.
| Compound Name | 2-(3,4-dichlorophenyl)-3-(4-methylbenzoyl)-N-pentyl-1,3-thiazolidine-4-carboxamide |
|---|---|
| PubChem CID | 42744012 |
| Molecular Formula | C23H26Cl2N2O2S |
| Molecular Weight | 465.45 g/mol |
| Exact Mass | 464.11 |
| IUPAC Name | 2-(3,4-dichlorophenyl)-3-(4-methylbenzoyl)-N-pentyl-1,3-thiazolidine-4-carboxamide |
| SMILES | CCCCCNC(=O)C1CSC(c2ccc(Cl)c(Cl)c2)N1C(=O)c1ccc(C)cc1 |
| InChI | InChI=1S/C23H26Cl2N2O2S/c1-3-4-5-12-26-21(28)20-14-30-23(17-10-11-18(24)19(25)13-17)27(20)22(29)16-8-6-15(2)7-9-16/h6-11,13,20,23H,3-5,12,14H2,1-2H3,(H,26,28) |
| InChIKey | XPTJEVGGSGCASA-UHFFFAOYSA-N |
| XLogP | 5.86 |
| TPSA | 49.41 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 465.45 |
| LogP ≤ 5 | 5.86 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|