C21H25ClN2O3S — CID 7356695
(2R,4R)-3-(2-chlorobenzoyl)-2-(furan-3-yl)-N-hexyl-1,3-thiazolidine-4-carboxamide (PubChem CID 7356695) has the molecular formula C21H25ClN2O3S and a molecular weight of 420.96 g/mol. Its IUPAC name is (2R,4R)-3-(2-chlorobenzoyl)-2-(furan-3-yl)-N-hexyl-1,3-thiazolidine-4-carboxamide.
| Compound Name | (2R,4R)-3-(2-chlorobenzoyl)-2-(furan-3-yl)-N-hexyl-1,3-thiazolidine-4-carboxamide |
|---|---|
| PubChem CID | 7356695 |
| Molecular Formula | C21H25ClN2O3S |
| Molecular Weight | 420.96 g/mol |
| Exact Mass | 420.13 |
| IUPAC Name | (2R,4R)-3-(2-chlorobenzoyl)-2-(furan-3-yl)-N-hexyl-1,3-thiazolidine-4-carboxamide |
| SMILES | CCCCCCNC(=O)[C@@H]1CS[C@H](c2ccoc2)N1C(=O)c1ccccc1Cl |
| InChI | InChI=1S/C21H25ClN2O3S/c1-2-3-4-7-11-23-19(25)18-14-28-21(15-10-12-27-13-15)24(18)20(26)16-8-5-6-9-17(16)22/h5-6,8-10,12-13,18,21H,2-4,7,11,14H2,1H3,(H,23,25)/t18-,21+/m0/s1 |
| InChIKey | OFCSYHWRAZSDGB-GHTZIAJQSA-N |
| XLogP | 4.89 |
| TPSA | 62.55 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 420.96 |
| LogP ≤ 5 | 4.89 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|