C21H22ClFN2O2S — CID 7288424
(2R,4S)-N-butyl-3-(2-chlorobenzoyl)-2-(3-fluorophenyl)-1,3-thiazolidine-4-carboxamide (PubChem CID 7288424) has the molecular formula C21H22ClFN2O2S and a molecular weight of 420.94 g/mol. Its IUPAC name is (2R,4S)-N-butyl-3-(2-chlorobenzoyl)-2-(3-fluorophenyl)-1,3-thiazolidine-4-carboxamide.
| Compound Name | (2R,4S)-N-butyl-3-(2-chlorobenzoyl)-2-(3-fluorophenyl)-1,3-thiazolidine-4-carboxamide |
|---|---|
| PubChem CID | 7288424 |
| Molecular Formula | C21H22ClFN2O2S |
| Molecular Weight | 420.94 g/mol |
| Exact Mass | 420.11 |
| IUPAC Name | (2R,4S)-N-butyl-3-(2-chlorobenzoyl)-2-(3-fluorophenyl)-1,3-thiazolidine-4-carboxamide |
| SMILES | CCCCNC(=O)[C@H]1CS[C@H](c2cccc(F)c2)N1C(=O)c1ccccc1Cl |
| InChI | InChI=1S/C21H22ClFN2O2S/c1-2-3-11-24-19(26)18-13-28-21(14-7-6-8-15(23)12-14)25(18)20(27)16-9-4-5-10-17(16)22/h4-10,12,18,21H,2-3,11,13H2,1H3,(H,24,26)/t18-,21-/m1/s1 |
| InChIKey | WZEWMLQTXPTBBO-WIYYLYMNSA-N |
| XLogP | 4.65 |
| TPSA | 49.41 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 420.94 |
| LogP ≤ 5 | 4.65 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|