C22H32N2O2S — CID 7355982
(2S,4S)-3-benzoyl-2-cyclohexyl-N-pentyl-1,3-thiazolidine-4-carboxamide (PubChem CID 7355982) has the molecular formula C22H32N2O2S and a molecular weight of 388.58 g/mol. Its IUPAC name is (2S,4S)-3-benzoyl-2-cyclohexyl-N-pentyl-1,3-thiazolidine-4-carboxamide.
| Compound Name | (2S,4S)-3-benzoyl-2-cyclohexyl-N-pentyl-1,3-thiazolidine-4-carboxamide |
|---|---|
| PubChem CID | 7355982 |
| Molecular Formula | C22H32N2O2S |
| Molecular Weight | 388.58 g/mol |
| Exact Mass | 388.22 |
| IUPAC Name | (2S,4S)-3-benzoyl-2-cyclohexyl-N-pentyl-1,3-thiazolidine-4-carboxamide |
| SMILES | CCCCCNC(=O)[C@H]1CS[C@@H](C2CCCCC2)N1C(=O)c1ccccc1 |
| InChI | InChI=1S/C22H32N2O2S/c1-2-3-10-15-23-20(25)19-16-27-22(18-13-8-5-9-14-18)24(19)21(26)17-11-6-4-7-12-17/h4,6-7,11-12,18-19,22H,2-3,5,8-10,13-16H2,1H3,(H,23,25)/t19-,22+/m1/s1 |
| InChIKey | YYSGGOMSWAYNCG-KNQAVFIVSA-N |
| XLogP | 4.46 |
| TPSA | 49.41 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 388.58 |
| LogP ≤ 5 | 4.46 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|