C21H29ClN2O3S — CID 42744147
3-(4-chlorobenzoyl)-2-cyclohexyl-N-(3-methoxypropyl)-1,3-thiazolidine-4-carboxamide (PubChem CID 42744147) has the molecular formula C21H29ClN2O3S and a molecular weight of 424.99 g/mol. Its IUPAC name is 3-(4-chlorobenzoyl)-2-cyclohexyl-N-(3-methoxypropyl)-1,3-thiazolidine-4-carboxamide.
| Compound Name | 3-(4-chlorobenzoyl)-2-cyclohexyl-N-(3-methoxypropyl)-1,3-thiazolidine-4-carboxamide |
|---|---|
| PubChem CID | 42744147 |
| Molecular Formula | C21H29ClN2O3S |
| Molecular Weight | 424.99 g/mol |
| Exact Mass | 424.16 |
| IUPAC Name | 3-(4-chlorobenzoyl)-2-cyclohexyl-N-(3-methoxypropyl)-1,3-thiazolidine-4-carboxamide |
| SMILES | COCCCNC(=O)C1CSC(C2CCCCC2)N1C(=O)c1ccc(Cl)cc1 |
| InChI | InChI=1S/C21H29ClN2O3S/c1-27-13-5-12-23-19(25)18-14-28-21(16-6-3-2-4-7-16)24(18)20(26)15-8-10-17(22)11-9-15/h8-11,16,18,21H,2-7,12-14H2,1H3,(H,23,25) |
| InChIKey | CFXXUIZIKIUTNJ-UHFFFAOYSA-N |
| XLogP | 3.96 |
| TPSA | 58.64 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 424.99 |
| LogP ≤ 5 | 3.96 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|