C21H28ClNO3S — CID 42729805
butyl 3-(4-chlorobenzoyl)-2-cyclohexyl-1,3-thiazolidine-4-carboxylate (PubChem CID 42729805) has the molecular formula C21H28ClNO3S and a molecular weight of 409.98 g/mol. Its IUPAC name is butyl 3-(4-chlorobenzoyl)-2-cyclohexyl-1,3-thiazolidine-4-carboxylate.
| Compound Name | butyl 3-(4-chlorobenzoyl)-2-cyclohexyl-1,3-thiazolidine-4-carboxylate |
|---|---|
| PubChem CID | 42729805 |
| Molecular Formula | C21H28ClNO3S |
| Molecular Weight | 409.98 g/mol |
| Exact Mass | 409.15 |
| IUPAC Name | butyl 3-(4-chlorobenzoyl)-2-cyclohexyl-1,3-thiazolidine-4-carboxylate |
| SMILES | CCCCOC(=O)C1CSC(C2CCCCC2)N1C(=O)c1ccc(Cl)cc1 |
| InChI | InChI=1S/C21H28ClNO3S/c1-2-3-13-26-21(25)18-14-27-20(16-7-5-4-6-8-16)23(18)19(24)15-9-11-17(22)12-10-15/h9-12,16,18,20H,2-8,13-14H2,1H3 |
| InChIKey | HIMBTKCZOYDTJV-UHFFFAOYSA-N |
| XLogP | 5.15 |
| TPSA | 46.61 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 409.98 |
| LogP ≤ 5 | 5.15 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|