C23H27NO3S — CID 42748893
butyl 2-ethyl-3-(4-phenylbenzoyl)-1,3-thiazolidine-4-carboxylate (PubChem CID 42748893) has the molecular formula C23H27NO3S and a molecular weight of 397.54 g/mol. Its IUPAC name is butyl 2-ethyl-3-(4-phenylbenzoyl)-1,3-thiazolidine-4-carboxylate.
| Compound Name | butyl 2-ethyl-3-(4-phenylbenzoyl)-1,3-thiazolidine-4-carboxylate |
|---|---|
| PubChem CID | 42748893 |
| Molecular Formula | C23H27NO3S |
| Molecular Weight | 397.54 g/mol |
| Exact Mass | 397.17 |
| IUPAC Name | butyl 2-ethyl-3-(4-phenylbenzoyl)-1,3-thiazolidine-4-carboxylate |
| SMILES | CCCCOC(=O)C1CSC(CC)N1C(=O)c1ccc(-c2ccccc2)cc1 |
| InChI | InChI=1S/C23H27NO3S/c1-3-5-15-27-23(26)20-16-28-21(4-2)24(20)22(25)19-13-11-18(12-14-19)17-9-7-6-8-10-17/h6-14,20-21H,3-5,15-16H2,1-2H3 |
| InChIKey | AJYVTGRNMZLBNO-UHFFFAOYSA-N |
| XLogP | 4.99 |
| TPSA | 46.61 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 397.54 |
| LogP ≤ 5 | 4.99 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|