C18H24FNO3S — CID 7396132
butyl (2S,4S)-3-(3-fluorobenzoyl)-2-propyl-1,3-thiazolidine-4-carboxylate (PubChem CID 7396132) has the molecular formula C18H24FNO3S and a molecular weight of 353.46 g/mol. Its IUPAC name is butyl (2S,4S)-3-(3-fluorobenzoyl)-2-propyl-1,3-thiazolidine-4-carboxylate.
| Compound Name | butyl (2S,4S)-3-(3-fluorobenzoyl)-2-propyl-1,3-thiazolidine-4-carboxylate |
|---|---|
| PubChem CID | 7396132 |
| Molecular Formula | C18H24FNO3S |
| Molecular Weight | 353.46 g/mol |
| Exact Mass | 353.15 |
| IUPAC Name | butyl (2S,4S)-3-(3-fluorobenzoyl)-2-propyl-1,3-thiazolidine-4-carboxylate |
| SMILES | CCCCOC(=O)[C@H]1CS[C@@H](CCC)N1C(=O)c1cccc(F)c1 |
| InChI | InChI=1S/C18H24FNO3S/c1-3-5-10-23-18(22)15-12-24-16(7-4-2)20(15)17(21)13-8-6-9-14(19)11-13/h6,8-9,11,15-16H,3-5,7,10,12H2,1-2H3/t15-,16+/m1/s1 |
| InChIKey | LVWXRZXKNACNLN-CVEARBPZSA-N |
| XLogP | 3.85 |
| TPSA | 46.61 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 353.46 |
| LogP ≤ 5 | 3.85 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|