C19H26ClNO3S — CID 42745476
butyl 3-(4-chlorobenzoyl)-2-(2-methylpropyl)-1,3-thiazolidine-4-carboxylate (PubChem CID 42745476) has the molecular formula C19H26ClNO3S and a molecular weight of 383.94 g/mol. Its IUPAC name is butyl 3-(4-chlorobenzoyl)-2-(2-methylpropyl)-1,3-thiazolidine-4-carboxylate.
| Compound Name | butyl 3-(4-chlorobenzoyl)-2-(2-methylpropyl)-1,3-thiazolidine-4-carboxylate |
|---|---|
| PubChem CID | 42745476 |
| Molecular Formula | C19H26ClNO3S |
| Molecular Weight | 383.94 g/mol |
| Exact Mass | 383.13 |
| IUPAC Name | butyl 3-(4-chlorobenzoyl)-2-(2-methylpropyl)-1,3-thiazolidine-4-carboxylate |
| SMILES | CCCCOC(=O)C1CSC(CC(C)C)N1C(=O)c1ccc(Cl)cc1 |
| InChI | InChI=1S/C19H26ClNO3S/c1-4-5-10-24-19(23)16-12-25-17(11-13(2)3)21(16)18(22)14-6-8-15(20)9-7-14/h6-9,13,16-17H,4-5,10-12H2,1-3H3 |
| InChIKey | AAWAGSGXSWUQIZ-UHFFFAOYSA-N |
| XLogP | 4.61 |
| TPSA | 46.61 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 383.94 |
| LogP ≤ 5 | 4.61 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|