C21H32N2O3S — CID 7301832
butyl (2R,4S)-3-[(4-ethylphenyl)carbamoyl]-2-(2-methylpropyl)-1,3-thiazolidine-4-carboxylate (PubChem CID 7301832) has the molecular formula C21H32N2O3S and a molecular weight of 392.57 g/mol. Its IUPAC name is butyl (2R,4S)-3-[(4-ethylphenyl)carbamoyl]-2-(2-methylpropyl)-1,3-thiazolidine-4-carboxylate.
| Compound Name | butyl (2R,4S)-3-[(4-ethylphenyl)carbamoyl]-2-(2-methylpropyl)-1,3-thiazolidine-4-carboxylate |
|---|---|
| PubChem CID | 7301832 |
| Molecular Formula | C21H32N2O3S |
| Molecular Weight | 392.57 g/mol |
| Exact Mass | 392.21 |
| IUPAC Name | butyl (2R,4S)-3-[(4-ethylphenyl)carbamoyl]-2-(2-methylpropyl)-1,3-thiazolidine-4-carboxylate |
| SMILES | CCCCOC(=O)[C@H]1CS[C@H](CC(C)C)N1C(=O)Nc1ccc(CC)cc1 |
| InChI | InChI=1S/C21H32N2O3S/c1-5-7-12-26-20(24)18-14-27-19(13-15(3)4)23(18)21(25)22-17-10-8-16(6-2)9-11-17/h8-11,15,18-19H,5-7,12-14H2,1-4H3,(H,22,25)/t18-,19-/m1/s1 |
| InChIKey | AUPUIINYGIWUCD-RTBURBONSA-N |
| XLogP | 4.91 |
| TPSA | 58.64 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 392.57 |
| LogP ≤ 5 | 4.91 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|