C18H24FNO3S — CID 7362470
butyl (2S,4R)-3-(2-fluorobenzoyl)-2-propan-2-yl-1,3-thiazolidine-4-carboxylate (PubChem CID 7362470) has the molecular formula C18H24FNO3S and a molecular weight of 353.46 g/mol. Its IUPAC name is butyl (2S,4R)-3-(2-fluorobenzoyl)-2-propan-2-yl-1,3-thiazolidine-4-carboxylate.
| Compound Name | butyl (2S,4R)-3-(2-fluorobenzoyl)-2-propan-2-yl-1,3-thiazolidine-4-carboxylate |
|---|---|
| PubChem CID | 7362470 |
| Molecular Formula | C18H24FNO3S |
| Molecular Weight | 353.46 g/mol |
| Exact Mass | 353.15 |
| IUPAC Name | butyl (2S,4R)-3-(2-fluorobenzoyl)-2-propan-2-yl-1,3-thiazolidine-4-carboxylate |
| SMILES | CCCCOC(=O)[C@@H]1CS[C@@H](C(C)C)N1C(=O)c1ccccc1F |
| InChI | InChI=1S/C18H24FNO3S/c1-4-5-10-23-18(22)15-11-24-17(12(2)3)20(15)16(21)13-8-6-7-9-14(13)19/h6-9,12,15,17H,4-5,10-11H2,1-3H3/t15-,17-/m0/s1 |
| InChIKey | RGCIQBAFNMLVME-RDJZCZTQSA-N |
| XLogP | 3.71 |
| TPSA | 46.61 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 353.46 |
| LogP ≤ 5 | 3.71 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|