C18H25NO3S — CID 7415565
butyl (2R,4S)-3-(2-methylpropanoyl)-2-phenyl-1,3-thiazolidine-4-carboxylate (PubChem CID 7415565) has the molecular formula C18H25NO3S and a molecular weight of 335.47 g/mol. Its IUPAC name is butyl (2R,4S)-3-(2-methylpropanoyl)-2-phenyl-1,3-thiazolidine-4-carboxylate.
| Compound Name | butyl (2R,4S)-3-(2-methylpropanoyl)-2-phenyl-1,3-thiazolidine-4-carboxylate |
|---|---|
| PubChem CID | 7415565 |
| Molecular Formula | C18H25NO3S |
| Molecular Weight | 335.47 g/mol |
| Exact Mass | 335.16 |
| IUPAC Name | butyl (2R,4S)-3-(2-methylpropanoyl)-2-phenyl-1,3-thiazolidine-4-carboxylate |
| SMILES | CCCCOC(=O)[C@H]1CS[C@H](c2ccccc2)N1C(=O)C(C)C |
| InChI | InChI=1S/C18H25NO3S/c1-4-5-11-22-18(21)15-12-23-17(14-9-7-6-8-10-14)19(15)16(20)13(2)3/h6-10,13,15,17H,4-5,11-12H2,1-3H3/t15-,17-/m1/s1 |
| InChIKey | YVJDCLBSKOXTOG-NVXWUHKLSA-N |
| XLogP | 3.63 |
| TPSA | 46.61 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 335.47 |
| LogP ≤ 5 | 3.63 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|