C17H24N2O3S — CID 7412355
(2R,4S)-N-(2-methoxyethyl)-3-(2-methylpropanoyl)-2-phenyl-1,3-thiazolidine-4-carboxamide (PubChem CID 7412355) has the molecular formula C17H24N2O3S and a molecular weight of 336.46 g/mol. Its IUPAC name is (2R,4S)-N-(2-methoxyethyl)-3-(2-methylpropanoyl)-2-phenyl-1,3-thiazolidine-4-carboxamide.
| Compound Name | (2R,4S)-N-(2-methoxyethyl)-3-(2-methylpropanoyl)-2-phenyl-1,3-thiazolidine-4-carboxamide |
|---|---|
| PubChem CID | 7412355 |
| Molecular Formula | C17H24N2O3S |
| Molecular Weight | 336.46 g/mol |
| Exact Mass | 336.15 |
| IUPAC Name | (2R,4S)-N-(2-methoxyethyl)-3-(2-methylpropanoyl)-2-phenyl-1,3-thiazolidine-4-carboxamide |
| SMILES | COCCNC(=O)[C@H]1CS[C@H](c2ccccc2)N1C(=O)C(C)C |
| InChI | InChI=1S/C17H24N2O3S/c1-12(2)16(21)19-14(15(20)18-9-10-22-3)11-23-17(19)13-7-5-4-6-8-13/h4-8,12,14,17H,9-11H2,1-3H3,(H,18,20)/t14-,17-/m1/s1 |
| InChIKey | ZCTWTMZCIQMMCS-RHSMWYFYSA-N |
| XLogP | 2.05 |
| TPSA | 58.64 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 336.46 |
| LogP ≤ 5 | 2.05 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|