C21H25N3O4S — CID 126458629
4-N-(2-methoxyethyl)-3-N-(2-methoxyphenyl)-2-phenyl-1,3-thiazolidine-3,4-dicarboxamide (PubChem CID 126458629) has the molecular formula C21H25N3O4S and a molecular weight of 415.52 g/mol. Its IUPAC name is 4-N-(2-methoxyethyl)-3-N-(2-methoxyphenyl)-2-phenyl-1,3-thiazolidine-3,4-dicarboxamide.
| Compound Name | 4-N-(2-methoxyethyl)-3-N-(2-methoxyphenyl)-2-phenyl-1,3-thiazolidine-3,4-dicarboxamide |
|---|---|
| PubChem CID | 126458629 |
| Molecular Formula | C21H25N3O4S |
| Molecular Weight | 415.52 g/mol |
| Exact Mass | 415.16 |
| IUPAC Name | 4-N-(2-methoxyethyl)-3-N-(2-methoxyphenyl)-2-phenyl-1,3-thiazolidine-3,4-dicarboxamide |
| SMILES | COCCNC(=O)C1CSC(c2ccccc2)N1C(=O)Nc1ccccc1OC |
| InChI | InChI=1S/C21H25N3O4S/c1-27-13-12-22-19(25)17-14-29-20(15-8-4-3-5-9-15)24(17)21(26)23-16-10-6-7-11-18(16)28-2/h3-11,17,20H,12-14H2,1-2H3,(H,22,25)(H,23,26) |
| InChIKey | OTSJOCUHPQAWRG-UHFFFAOYSA-N |
| XLogP | 3.11 |
| TPSA | 79.90 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 415.52 |
| LogP ≤ 5 | 3.11 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|