C24H26ClNO3S — CID 4020625
butyl 2-(2-chlorophenyl)-3-(2-phenylcyclopropanecarbonyl)-1,3-thiazolidine-4-carboxylate (PubChem CID 4020625) has the molecular formula C24H26ClNO3S and a molecular weight of 444.00 g/mol. Its IUPAC name is butyl 2-(2-chlorophenyl)-3-(2-phenylcyclopropanecarbonyl)-1,3-thiazolidine-4-carboxylate.
| Compound Name | butyl 2-(2-chlorophenyl)-3-(2-phenylcyclopropanecarbonyl)-1,3-thiazolidine-4-carboxylate |
|---|---|
| PubChem CID | 4020625 |
| Molecular Formula | C24H26ClNO3S |
| Molecular Weight | 444.00 g/mol |
| Exact Mass | 443.13 |
| IUPAC Name | butyl 2-(2-chlorophenyl)-3-(2-phenylcyclopropanecarbonyl)-1,3-thiazolidine-4-carboxylate |
| SMILES | CCCCOC(=O)C1CSC(c2ccccc2Cl)N1C(=O)C1CC1c1ccccc1 |
| InChI | InChI=1S/C24H26ClNO3S/c1-2-3-13-29-24(28)21-15-30-23(17-11-7-8-12-20(17)25)26(21)22(27)19-14-18(19)16-9-5-4-6-10-16/h4-12,18-19,21,23H,2-3,13-15H2,1H3 |
| InChIKey | FBKRMYGUWKMXBK-UHFFFAOYSA-N |
| XLogP | 5.43 |
| TPSA | 46.61 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 444.00 |
| LogP ≤ 5 | 5.43 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|