C23H27ClN2O3S — CID 4305902
butyl 2-(2-chlorophenyl)-3-[(2,6-dimethylphenyl)carbamoyl]-1,3-thiazolidine-4-carboxylate (PubChem CID 4305902) has the molecular formula C23H27ClN2O3S and a molecular weight of 447.00 g/mol. Its IUPAC name is butyl 2-(2-chlorophenyl)-3-[(2,6-dimethylphenyl)carbamoyl]-1,3-thiazolidine-4-carboxylate.
| Compound Name | butyl 2-(2-chlorophenyl)-3-[(2,6-dimethylphenyl)carbamoyl]-1,3-thiazolidine-4-carboxylate |
|---|---|
| PubChem CID | 4305902 |
| Molecular Formula | C23H27ClN2O3S |
| Molecular Weight | 447.00 g/mol |
| Exact Mass | 446.14 |
| IUPAC Name | butyl 2-(2-chlorophenyl)-3-[(2,6-dimethylphenyl)carbamoyl]-1,3-thiazolidine-4-carboxylate |
| SMILES | CCCCOC(=O)C1CSC(c2ccccc2Cl)N1C(=O)Nc1c(C)cccc1C |
| InChI | InChI=1S/C23H27ClN2O3S/c1-4-5-13-29-22(27)19-14-30-21(17-11-6-7-12-18(17)24)26(19)23(28)25-20-15(2)9-8-10-16(20)3/h6-12,19,21H,4-5,13-14H2,1-3H3,(H,25,28) |
| InChIKey | ZLESCVGKYVGFKL-UHFFFAOYSA-N |
| XLogP | 5.95 |
| TPSA | 58.64 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 447.00 |
| LogP ≤ 5 | 5.95 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|