C19H26ClNO3S — CID 7439910
propyl (2R,4S)-2-(2-chlorophenyl)-3-hexanoyl-1,3-thiazolidine-4-carboxylate (PubChem CID 7439910) has the molecular formula C19H26ClNO3S and a molecular weight of 383.94 g/mol. Its IUPAC name is propyl (2R,4S)-2-(2-chlorophenyl)-3-hexanoyl-1,3-thiazolidine-4-carboxylate.
| Compound Name | propyl (2R,4S)-2-(2-chlorophenyl)-3-hexanoyl-1,3-thiazolidine-4-carboxylate |
|---|---|
| PubChem CID | 7439910 |
| Molecular Formula | C19H26ClNO3S |
| Molecular Weight | 383.94 g/mol |
| Exact Mass | 383.13 |
| IUPAC Name | propyl (2R,4S)-2-(2-chlorophenyl)-3-hexanoyl-1,3-thiazolidine-4-carboxylate |
| SMILES | CCCCCC(=O)N1[C@@H](C(=O)OCCC)CS[C@@H]1c1ccccc1Cl |
| InChI | InChI=1S/C19H26ClNO3S/c1-3-5-6-11-17(22)21-16(19(23)24-12-4-2)13-25-18(21)14-9-7-8-10-15(14)20/h7-10,16,18H,3-6,11-13H2,1-2H3/t16-,18-/m1/s1 |
| InChIKey | LGSBMIYLXRDSRU-SJLPKXTDSA-N |
| XLogP | 4.82 |
| TPSA | 46.61 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 383.94 |
| LogP ≤ 5 | 4.82 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|