C21H32N2O5S — CID 7232189
butyl (2S,4R)-3-[(2,4-dimethoxyphenyl)carbamoyl]-2-(2-methylpropyl)-1,3-thiazolidine-4-carboxylate (PubChem CID 7232189) has the molecular formula C21H32N2O5S and a molecular weight of 424.56 g/mol. Its IUPAC name is butyl (2S,4R)-3-[(2,4-dimethoxyphenyl)carbamoyl]-2-(2-methylpropyl)-1,3-thiazolidine-4-carboxylate.
| Compound Name | butyl (2S,4R)-3-[(2,4-dimethoxyphenyl)carbamoyl]-2-(2-methylpropyl)-1,3-thiazolidine-4-carboxylate |
|---|---|
| PubChem CID | 7232189 |
| Molecular Formula | C21H32N2O5S |
| Molecular Weight | 424.56 g/mol |
| Exact Mass | 424.20 |
| IUPAC Name | butyl (2S,4R)-3-[(2,4-dimethoxyphenyl)carbamoyl]-2-(2-methylpropyl)-1,3-thiazolidine-4-carboxylate |
| SMILES | CCCCOC(=O)[C@@H]1CS[C@@H](CC(C)C)N1C(=O)Nc1ccc(OC)cc1OC |
| InChI | InChI=1S/C21H32N2O5S/c1-6-7-10-28-20(24)17-13-29-19(11-14(2)3)23(17)21(25)22-16-9-8-15(26-4)12-18(16)27-5/h8-9,12,14,17,19H,6-7,10-11,13H2,1-5H3,(H,22,25)/t17-,19-/m0/s1 |
| InChIKey | WGJBQOUAMLIUJO-HKUYNNGSSA-N |
| XLogP | 4.37 |
| TPSA | 77.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 424.56 |
| LogP ≤ 5 | 4.37 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|