C19H27NO5S — CID 42729387
methyl 3-(2,6-dimethoxybenzoyl)-2-pentyl-1,3-thiazolidine-4-carboxylate (PubChem CID 42729387) has the molecular formula C19H27NO5S and a molecular weight of 381.49 g/mol. Its IUPAC name is methyl 3-(2,6-dimethoxybenzoyl)-2-pentyl-1,3-thiazolidine-4-carboxylate.
| Compound Name | methyl 3-(2,6-dimethoxybenzoyl)-2-pentyl-1,3-thiazolidine-4-carboxylate |
|---|---|
| PubChem CID | 42729387 |
| Molecular Formula | C19H27NO5S |
| Molecular Weight | 381.49 g/mol |
| Exact Mass | 381.16 |
| IUPAC Name | methyl 3-(2,6-dimethoxybenzoyl)-2-pentyl-1,3-thiazolidine-4-carboxylate |
| SMILES | CCCCCC1SCC(C(=O)OC)N1C(=O)c1c(OC)cccc1OC |
| InChI | InChI=1S/C19H27NO5S/c1-5-6-7-11-16-20(13(12-26-16)19(22)25-4)18(21)17-14(23-2)9-8-10-15(17)24-3/h8-10,13,16H,5-7,11-12H2,1-4H3 |
| InChIKey | YEEYLGYEOOXVJL-UHFFFAOYSA-N |
| XLogP | 3.34 |
| TPSA | 65.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 381.49 |
| LogP ≤ 5 | 3.34 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|