C23H36N2O4S — CID 42744473
3-(3,5-dimethoxybenzoyl)-N-(3-methylbutan-2-yl)-2-pentyl-1,3-thiazolidine-4-carboxamide (PubChem CID 42744473) has the molecular formula C23H36N2O4S and a molecular weight of 436.62 g/mol. Its IUPAC name is 3-(3,5-dimethoxybenzoyl)-N-(3-methylbutan-2-yl)-2-pentyl-1,3-thiazolidine-4-carboxamide.
| Compound Name | 3-(3,5-dimethoxybenzoyl)-N-(3-methylbutan-2-yl)-2-pentyl-1,3-thiazolidine-4-carboxamide |
|---|---|
| PubChem CID | 42744473 |
| Molecular Formula | C23H36N2O4S |
| Molecular Weight | 436.62 g/mol |
| Exact Mass | 436.24 |
| IUPAC Name | 3-(3,5-dimethoxybenzoyl)-N-(3-methylbutan-2-yl)-2-pentyl-1,3-thiazolidine-4-carboxamide |
| SMILES | CCCCCC1SCC(C(=O)NC(C)C(C)C)N1C(=O)c1cc(OC)cc(OC)c1 |
| InChI | InChI=1S/C23H36N2O4S/c1-7-8-9-10-21-25(20(14-30-21)22(26)24-16(4)15(2)3)23(27)17-11-18(28-5)13-19(12-17)29-6/h11-13,15-16,20-21H,7-10,14H2,1-6H3,(H,24,26) |
| InChIKey | OVDIEDQFHYKONQ-UHFFFAOYSA-N |
| XLogP | 4.33 |
| TPSA | 67.87 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 436.62 |
| LogP ≤ 5 | 4.33 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|