C25H31NO3S — CID 42727813
methyl 3-(4-pentylbenzoyl)-2-(2-phenylethyl)-1,3-thiazolidine-4-carboxylate (PubChem CID 42727813) has the molecular formula C25H31NO3S and a molecular weight of 425.59 g/mol. Its IUPAC name is methyl 3-(4-pentylbenzoyl)-2-(2-phenylethyl)-1,3-thiazolidine-4-carboxylate.
| Compound Name | methyl 3-(4-pentylbenzoyl)-2-(2-phenylethyl)-1,3-thiazolidine-4-carboxylate |
|---|---|
| PubChem CID | 42727813 |
| Molecular Formula | C25H31NO3S |
| Molecular Weight | 425.59 g/mol |
| Exact Mass | 425.20 |
| IUPAC Name | methyl 3-(4-pentylbenzoyl)-2-(2-phenylethyl)-1,3-thiazolidine-4-carboxylate |
| SMILES | CCCCCc1ccc(C(=O)N2C(CCc3ccccc3)SCC2C(=O)OC)cc1 |
| InChI | InChI=1S/C25H31NO3S/c1-3-4-6-9-20-12-15-21(16-13-20)24(27)26-22(25(28)29-2)18-30-23(26)17-14-19-10-7-5-8-11-19/h5,7-8,10-13,15-16,22-23H,3-4,6,9,14,17-18H2,1-2H3 |
| InChIKey | DVQMNAPBCCWUSX-UHFFFAOYSA-N |
| XLogP | 5.11 |
| TPSA | 46.61 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 425.59 |
| LogP ≤ 5 | 5.11 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|