C18H25NO3S — CID 42728675
2-pentyl-3-(3-phenylpropanoyl)-1,3-thiazolidine-4-carboxylic acid (PubChem CID 42728675) has the molecular formula C18H25NO3S and a molecular weight of 335.47 g/mol. Its IUPAC name is 2-pentyl-3-(3-phenylpropanoyl)-1,3-thiazolidine-4-carboxylic acid.
| Compound Name | 2-pentyl-3-(3-phenylpropanoyl)-1,3-thiazolidine-4-carboxylic acid |
|---|---|
| PubChem CID | 42728675 |
| Molecular Formula | C18H25NO3S |
| Molecular Weight | 335.47 g/mol |
| Exact Mass | 335.16 |
| IUPAC Name | 2-pentyl-3-(3-phenylpropanoyl)-1,3-thiazolidine-4-carboxylic acid |
| SMILES | CCCCCC1SCC(C(=O)O)N1C(=O)CCc1ccccc1 |
| InChI | InChI=1S/C18H25NO3S/c1-2-3-5-10-17-19(15(13-23-17)18(21)22)16(20)12-11-14-8-6-4-7-9-14/h4,6-9,15,17H,2-3,5,10-13H2,1H3,(H,21,22) |
| InChIKey | SMPURKXCOMLZNE-UHFFFAOYSA-N |
| XLogP | 3.55 |
| TPSA | 57.61 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 335.47 |
| LogP ≤ 5 | 3.55 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|