C15H27NO3S — CID 63792526
2-ethyl-3-nonanoyl-1,3-thiazolidine-4-carboxylic acid (PubChem CID 63792526) has the molecular formula C15H27NO3S and a molecular weight of 301.45 g/mol. Its IUPAC name is 2-ethyl-3-nonanoyl-1,3-thiazolidine-4-carboxylic acid.
| Compound Name | 2-ethyl-3-nonanoyl-1,3-thiazolidine-4-carboxylic acid |
|---|---|
| PubChem CID | 63792526 |
| Molecular Formula | C15H27NO3S |
| Molecular Weight | 301.45 g/mol |
| Exact Mass | 301.17 |
| IUPAC Name | 2-ethyl-3-nonanoyl-1,3-thiazolidine-4-carboxylic acid |
| SMILES | CCCCCCCCC(=O)N1C(CC)SCC1C(=O)O |
| InChI | InChI=1S/C15H27NO3S/c1-3-5-6-7-8-9-10-13(17)16-12(15(18)19)11-20-14(16)4-2/h12,14H,3-11H2,1-2H3,(H,18,19) |
| InChIKey | ZXLOWIMSVZWUDF-UHFFFAOYSA-N |
| XLogP | 3.50 |
| TPSA | 57.61 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 301.45 |
| LogP ≤ 5 | 3.50 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|