C21H25NO3S — CID 42729362
methyl 3-(naphthalene-2-carbonyl)-2-pentyl-1,3-thiazolidine-4-carboxylate (PubChem CID 42729362) has the molecular formula C21H25NO3S and a molecular weight of 371.50 g/mol. Its IUPAC name is methyl 3-(naphthalene-2-carbonyl)-2-pentyl-1,3-thiazolidine-4-carboxylate.
| Compound Name | methyl 3-(naphthalene-2-carbonyl)-2-pentyl-1,3-thiazolidine-4-carboxylate |
|---|---|
| PubChem CID | 42729362 |
| Molecular Formula | C21H25NO3S |
| Molecular Weight | 371.50 g/mol |
| Exact Mass | 371.16 |
| IUPAC Name | methyl 3-(naphthalene-2-carbonyl)-2-pentyl-1,3-thiazolidine-4-carboxylate |
| SMILES | CCCCCC1SCC(C(=O)OC)N1C(=O)c1ccc2ccccc2c1 |
| InChI | InChI=1S/C21H25NO3S/c1-3-4-5-10-19-22(18(14-26-19)21(24)25-2)20(23)17-12-11-15-8-6-7-9-16(15)13-17/h6-9,11-13,18-19H,3-5,10,14H2,1-2H3 |
| InChIKey | ISODWZPWDRNPBE-UHFFFAOYSA-N |
| XLogP | 4.48 |
| TPSA | 46.61 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 371.50 |
| LogP ≤ 5 | 4.48 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|