C18H24ClNO4S — CID 93096262
methyl (2S,4R)-3-[2-(4-chlorophenoxy)acetyl]-2-pentyl-1,3-thiazolidine-4-carboxylate (PubChem CID 93096262) has the molecular formula C18H24ClNO4S and a molecular weight of 385.91 g/mol. Its IUPAC name is methyl (2S,4R)-3-[2-(4-chlorophenoxy)acetyl]-2-pentyl-1,3-thiazolidine-4-carboxylate.
| Compound Name | methyl (2S,4R)-3-[2-(4-chlorophenoxy)acetyl]-2-pentyl-1,3-thiazolidine-4-carboxylate |
|---|---|
| PubChem CID | 93096262 |
| Molecular Formula | C18H24ClNO4S |
| Molecular Weight | 385.91 g/mol |
| Exact Mass | 385.11 |
| IUPAC Name | methyl (2S,4R)-3-[2-(4-chlorophenoxy)acetyl]-2-pentyl-1,3-thiazolidine-4-carboxylate |
| SMILES | CCCCC[C@@H]1SC[C@@H](C(=O)OC)N1C(=O)COc1ccc(Cl)cc1 |
| InChI | InChI=1S/C18H24ClNO4S/c1-3-4-5-6-17-20(15(12-25-17)18(22)23-2)16(21)11-24-14-9-7-13(19)8-10-14/h7-10,15,17H,3-6,11-12H2,1-2H3/t15-,17-/m0/s1 |
| InChIKey | QZCHOSCHBCVEMU-RDJZCZTQSA-N |
| XLogP | 3.74 |
| TPSA | 55.84 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 385.91 |
| LogP ≤ 5 | 3.74 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|