C18H23Cl2NO3S — CID 42748997
butyl 3-(2,4-dichlorobenzoyl)-2-propyl-1,3-thiazolidine-4-carboxylate (PubChem CID 42748997) has the molecular formula C18H23Cl2NO3S and a molecular weight of 404.36 g/mol. Its IUPAC name is butyl 3-(2,4-dichlorobenzoyl)-2-propyl-1,3-thiazolidine-4-carboxylate.
| Compound Name | butyl 3-(2,4-dichlorobenzoyl)-2-propyl-1,3-thiazolidine-4-carboxylate |
|---|---|
| PubChem CID | 42748997 |
| Molecular Formula | C18H23Cl2NO3S |
| Molecular Weight | 404.36 g/mol |
| Exact Mass | 403.08 |
| IUPAC Name | butyl 3-(2,4-dichlorobenzoyl)-2-propyl-1,3-thiazolidine-4-carboxylate |
| SMILES | CCCCOC(=O)C1CSC(CCC)N1C(=O)c1ccc(Cl)cc1Cl |
| InChI | InChI=1S/C18H23Cl2NO3S/c1-3-5-9-24-18(23)15-11-25-16(6-4-2)21(15)17(22)13-8-7-12(19)10-14(13)20/h7-8,10,15-16H,3-6,9,11H2,1-2H3 |
| InChIKey | FCWNSYUXIFCEBW-UHFFFAOYSA-N |
| XLogP | 5.02 |
| TPSA | 46.61 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 25 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 404.36 |
| LogP ≤ 5 | 5.02 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|