C15H27NO3S — CID 42748996
butyl 3-butanoyl-2-propyl-1,3-thiazolidine-4-carboxylate (PubChem CID 42748996) has the molecular formula C15H27NO3S and a molecular weight of 301.45 g/mol. Its IUPAC name is butyl 3-butanoyl-2-propyl-1,3-thiazolidine-4-carboxylate.
| Compound Name | butyl 3-butanoyl-2-propyl-1,3-thiazolidine-4-carboxylate |
|---|---|
| PubChem CID | 42748996 |
| Molecular Formula | C15H27NO3S |
| Molecular Weight | 301.45 g/mol |
| Exact Mass | 301.17 |
| IUPAC Name | butyl 3-butanoyl-2-propyl-1,3-thiazolidine-4-carboxylate |
| SMILES | CCCCOC(=O)C1CSC(CCC)N1C(=O)CCC |
| InChI | InChI=1S/C15H27NO3S/c1-4-7-10-19-15(18)12-11-20-14(9-6-3)16(12)13(17)8-5-2/h12,14H,4-11H2,1-3H3 |
| InChIKey | VNIWNCOCUHHXGR-UHFFFAOYSA-N |
| XLogP | 3.20 |
| TPSA | 46.61 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 301.45 |
| LogP ≤ 5 | 3.20 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|