C19H33NO5S — CID 89483188
diethyl 3-decanoyl-1,3-thiazolidine-2,4-dicarboxylate (PubChem CID 89483188) has the molecular formula C19H33NO5S and a molecular weight of 387.54 g/mol. Its IUPAC name is diethyl 3-decanoyl-1,3-thiazolidine-2,4-dicarboxylate.
| Compound Name | diethyl 3-decanoyl-1,3-thiazolidine-2,4-dicarboxylate |
|---|---|
| PubChem CID | 89483188 |
| Molecular Formula | C19H33NO5S |
| Molecular Weight | 387.54 g/mol |
| Exact Mass | 387.21 |
| IUPAC Name | diethyl 3-decanoyl-1,3-thiazolidine-2,4-dicarboxylate |
| SMILES | CCCCCCCCCC(=O)N1C(C(=O)OCC)CSC1C(=O)OCC |
| InChI | InChI=1S/C19H33NO5S/c1-4-7-8-9-10-11-12-13-16(21)20-15(18(22)24-5-2)14-26-17(20)19(23)25-6-3/h15,17H,4-14H2,1-3H3 |
| InChIKey | JUZYXMMUJLZZRP-UHFFFAOYSA-N |
| XLogP | 3.52 |
| TPSA | 72.91 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 387.54 |
| LogP ≤ 5 | 3.52 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|