C18H31NO3S — CID 42729761
methyl 2-cyclohexyl-3-heptanoyl-1,3-thiazolidine-4-carboxylate (PubChem CID 42729761) has the molecular formula C18H31NO3S and a molecular weight of 341.52 g/mol. Its IUPAC name is methyl 2-cyclohexyl-3-heptanoyl-1,3-thiazolidine-4-carboxylate.
| Compound Name | methyl 2-cyclohexyl-3-heptanoyl-1,3-thiazolidine-4-carboxylate |
|---|---|
| PubChem CID | 42729761 |
| Molecular Formula | C18H31NO3S |
| Molecular Weight | 341.52 g/mol |
| Exact Mass | 341.20 |
| IUPAC Name | methyl 2-cyclohexyl-3-heptanoyl-1,3-thiazolidine-4-carboxylate |
| SMILES | CCCCCCC(=O)N1C(C(=O)OC)CSC1C1CCCCC1 |
| InChI | InChI=1S/C18H31NO3S/c1-3-4-5-9-12-16(20)19-15(18(21)22-2)13-23-17(19)14-10-7-6-8-11-14/h14-15,17H,3-13H2,1-2H3 |
| InChIKey | NVSXGGCPNBZSRH-UHFFFAOYSA-N |
| XLogP | 3.98 |
| TPSA | 46.61 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 341.52 |
| LogP ≤ 5 | 3.98 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|