C17H29NO4S — CID 42658122
butyl 2-cyclohexyl-3-(2-methoxyacetyl)-1,3-thiazolidine-4-carboxylate (PubChem CID 42658122) has the molecular formula C17H29NO4S and a molecular weight of 343.49 g/mol. Its IUPAC name is butyl 2-cyclohexyl-3-(2-methoxyacetyl)-1,3-thiazolidine-4-carboxylate.
| Compound Name | butyl 2-cyclohexyl-3-(2-methoxyacetyl)-1,3-thiazolidine-4-carboxylate |
|---|---|
| PubChem CID | 42658122 |
| Molecular Formula | C17H29NO4S |
| Molecular Weight | 343.49 g/mol |
| Exact Mass | 343.18 |
| IUPAC Name | butyl 2-cyclohexyl-3-(2-methoxyacetyl)-1,3-thiazolidine-4-carboxylate |
| SMILES | CCCCOC(=O)C1CSC(C2CCCCC2)N1C(=O)COC |
| InChI | InChI=1S/C17H29NO4S/c1-3-4-10-22-17(20)14-12-23-16(13-8-6-5-7-9-13)18(14)15(19)11-21-2/h13-14,16H,3-12H2,1-2H3 |
| InChIKey | DTZSYQPFRGJQEJ-UHFFFAOYSA-N |
| XLogP | 2.83 |
| TPSA | 55.84 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 343.49 |
| LogP ≤ 5 | 2.83 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|