C20H27F3N2O3S — CID 5154107
butyl 2-(2-methylpropyl)-3-[[3-(trifluoromethyl)phenyl]carbamoyl]-1,3-thiazolidine-4-carboxylate (PubChem CID 5154107) has the molecular formula C20H27F3N2O3S and a molecular weight of 432.51 g/mol. Its IUPAC name is butyl 2-(2-methylpropyl)-3-[[3-(trifluoromethyl)phenyl]carbamoyl]-1,3-thiazolidine-4-carboxylate.
| Compound Name | butyl 2-(2-methylpropyl)-3-[[3-(trifluoromethyl)phenyl]carbamoyl]-1,3-thiazolidine-4-carboxylate |
|---|---|
| PubChem CID | 5154107 |
| Molecular Formula | C20H27F3N2O3S |
| Molecular Weight | 432.51 g/mol |
| Exact Mass | 432.17 |
| IUPAC Name | butyl 2-(2-methylpropyl)-3-[[3-(trifluoromethyl)phenyl]carbamoyl]-1,3-thiazolidine-4-carboxylate |
| SMILES | CCCCOC(=O)C1CSC(CC(C)C)N1C(=O)Nc1cccc(C(F)(F)F)c1 |
| InChI | InChI=1S/C20H27F3N2O3S/c1-4-5-9-28-18(26)16-12-29-17(10-13(2)3)25(16)19(27)24-15-8-6-7-14(11-15)20(21,22)23/h6-8,11,13,16-17H,4-5,9-10,12H2,1-3H3,(H,24,27) |
| InChIKey | XAVVWAQRIYMBIT-UHFFFAOYSA-N |
| XLogP | 5.37 |
| TPSA | 58.64 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 432.51 |
| LogP ≤ 5 | 5.37 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|