C20H27N3O3S — CID 3561948
butyl 3-[(4-cyanophenyl)carbamoyl]-2-(2-methylpropyl)-1,3-thiazolidine-4-carboxylate (PubChem CID 3561948) has the molecular formula C20H27N3O3S and a molecular weight of 389.52 g/mol. Its IUPAC name is butyl 3-[(4-cyanophenyl)carbamoyl]-2-(2-methylpropyl)-1,3-thiazolidine-4-carboxylate.
| Compound Name | butyl 3-[(4-cyanophenyl)carbamoyl]-2-(2-methylpropyl)-1,3-thiazolidine-4-carboxylate |
|---|---|
| PubChem CID | 3561948 |
| Molecular Formula | C20H27N3O3S |
| Molecular Weight | 389.52 g/mol |
| Exact Mass | 389.18 |
| IUPAC Name | butyl 3-[(4-cyanophenyl)carbamoyl]-2-(2-methylpropyl)-1,3-thiazolidine-4-carboxylate |
| SMILES | CCCCOC(=O)C1CSC(CC(C)C)N1C(=O)Nc1ccc(C#N)cc1 |
| InChI | InChI=1S/C20H27N3O3S/c1-4-5-10-26-19(24)17-13-27-18(11-14(2)3)23(17)20(25)22-16-8-6-15(12-21)7-9-16/h6-9,14,17-18H,4-5,10-11,13H2,1-3H3,(H,22,25) |
| InChIKey | SRGUDWBZWNTQEL-UHFFFAOYSA-N |
| XLogP | 4.22 |
| TPSA | 82.43 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 389.52 |
| LogP ≤ 5 | 4.22 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|