C19H21FN2O4S — CID 42745149
3-(4-fluorobenzoyl)-2-(furan-3-yl)-N-(3-methoxypropyl)-1,3-thiazolidine-4-carboxamide (PubChem CID 42745149) has the molecular formula C19H21FN2O4S and a molecular weight of 392.45 g/mol. Its IUPAC name is 3-(4-fluorobenzoyl)-2-(furan-3-yl)-N-(3-methoxypropyl)-1,3-thiazolidine-4-carboxamide.
| Compound Name | 3-(4-fluorobenzoyl)-2-(furan-3-yl)-N-(3-methoxypropyl)-1,3-thiazolidine-4-carboxamide |
|---|---|
| PubChem CID | 42745149 |
| Molecular Formula | C19H21FN2O4S |
| Molecular Weight | 392.45 g/mol |
| Exact Mass | 392.12 |
| IUPAC Name | 3-(4-fluorobenzoyl)-2-(furan-3-yl)-N-(3-methoxypropyl)-1,3-thiazolidine-4-carboxamide |
| SMILES | COCCCNC(=O)C1CSC(c2ccoc2)N1C(=O)c1ccc(F)cc1 |
| InChI | InChI=1S/C19H21FN2O4S/c1-25-9-2-8-21-17(23)16-12-27-19(14-7-10-26-11-14)22(16)18(24)13-3-5-15(20)6-4-13/h3-7,10-11,16,19H,2,8-9,12H2,1H3,(H,21,23) |
| InChIKey | ZWWDXXMOLGLCHG-UHFFFAOYSA-N |
| XLogP | 2.83 |
| TPSA | 71.78 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 392.45 |
| LogP ≤ 5 | 2.83 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|