C24H34FN3O3S — CID 5137356
2-cyclohexyl-3-(4-fluorobenzoyl)-N-(3-morpholin-4-ylpropyl)-1,3-thiazolidine-4-carboxamide (PubChem CID 5137356) has the molecular formula C24H34FN3O3S and a molecular weight of 463.62 g/mol. Its IUPAC name is 2-cyclohexyl-3-(4-fluorobenzoyl)-N-(3-morpholin-4-ylpropyl)-1,3-thiazolidine-4-carboxamide.
| Compound Name | 2-cyclohexyl-3-(4-fluorobenzoyl)-N-(3-morpholin-4-ylpropyl)-1,3-thiazolidine-4-carboxamide |
|---|---|
| PubChem CID | 5137356 |
| Molecular Formula | C24H34FN3O3S |
| Molecular Weight | 463.62 g/mol |
| Exact Mass | 463.23 |
| IUPAC Name | 2-cyclohexyl-3-(4-fluorobenzoyl)-N-(3-morpholin-4-ylpropyl)-1,3-thiazolidine-4-carboxamide |
| SMILES | O=C(NCCCN1CCOCC1)C1CSC(C2CCCCC2)N1C(=O)c1ccc(F)cc1 |
| InChI | InChI=1S/C24H34FN3O3S/c25-20-9-7-18(8-10-20)23(30)28-21(17-32-24(28)19-5-2-1-3-6-19)22(29)26-11-4-12-27-13-15-31-16-14-27/h7-10,19,21,24H,1-6,11-17H2,(H,26,29) |
| InChIKey | QPIXGZAUOFKUIX-UHFFFAOYSA-N |
| XLogP | 3.13 |
| TPSA | 61.88 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 463.62 |
| LogP ≤ 5 | 3.13 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|