C21H30FN3O3S — CID 42748611
2-(3-fluorophenyl)-3-(2-methylpropanoyl)-N-(3-morpholin-4-ylpropyl)-1,3-thiazolidine-4-carboxamide (PubChem CID 42748611) has the molecular formula C21H30FN3O3S and a molecular weight of 423.55 g/mol. Its IUPAC name is 2-(3-fluorophenyl)-3-(2-methylpropanoyl)-N-(3-morpholin-4-ylpropyl)-1,3-thiazolidine-4-carboxamide.
| Compound Name | 2-(3-fluorophenyl)-3-(2-methylpropanoyl)-N-(3-morpholin-4-ylpropyl)-1,3-thiazolidine-4-carboxamide |
|---|---|
| PubChem CID | 42748611 |
| Molecular Formula | C21H30FN3O3S |
| Molecular Weight | 423.55 g/mol |
| Exact Mass | 423.20 |
| IUPAC Name | 2-(3-fluorophenyl)-3-(2-methylpropanoyl)-N-(3-morpholin-4-ylpropyl)-1,3-thiazolidine-4-carboxamide |
| SMILES | CC(C)C(=O)N1C(C(=O)NCCCN2CCOCC2)CSC1c1cccc(F)c1 |
| InChI | InChI=1S/C21H30FN3O3S/c1-15(2)20(27)25-18(14-29-21(25)16-5-3-6-17(22)13-16)19(26)23-7-4-8-24-9-11-28-12-10-24/h3,5-6,13,15,18,21H,4,7-12,14H2,1-2H3,(H,23,26) |
| InChIKey | NHCKTBHTDPLHFI-UHFFFAOYSA-N |
| XLogP | 2.26 |
| TPSA | 61.88 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 423.55 |
| LogP ≤ 5 | 2.26 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|