C22H29ClN2OS — CID 166633188
(2-chlorophenyl)-(4-heptyl-3-thiophen-2-ylpiperazin-1-yl)methanone (PubChem CID 166633188) has the molecular formula C22H29ClN2OS and a molecular weight of 405.01 g/mol. Its IUPAC name is (2-chlorophenyl)-(4-heptyl-3-thiophen-2-ylpiperazin-1-yl)methanone.
| Compound Name | (2-chlorophenyl)-(4-heptyl-3-thiophen-2-ylpiperazin-1-yl)methanone |
|---|---|
| PubChem CID | 166633188 |
| Molecular Formula | C22H29ClN2OS |
| Molecular Weight | 405.01 g/mol |
| Exact Mass | 404.17 |
| IUPAC Name | (2-chlorophenyl)-(4-heptyl-3-thiophen-2-ylpiperazin-1-yl)methanone |
| SMILES | CCCCCCCN1CCN(C(=O)c2ccccc2Cl)CC1c1cccs1 |
| InChI | InChI=1S/C22H29ClN2OS/c1-2-3-4-5-8-13-24-14-15-25(17-20(24)21-12-9-16-27-21)22(26)18-10-6-7-11-19(18)23/h6-7,9-12,16,20H,2-5,8,13-15,17H2,1H3 |
| InChIKey | STASGJACHFVJHN-UHFFFAOYSA-N |
| XLogP | 5.87 |
| TPSA | 23.55 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 405.01 |
| LogP ≤ 5 | 5.87 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|