C19H26ClNO3 — CID 91734475
hexyl 1-(2-chlorobenzoyl)piperidine-4-carboxylate (PubChem CID 91734475) has the molecular formula C19H26ClNO3 and a molecular weight of 351.87 g/mol. Its IUPAC name is hexyl 1-(2-chlorobenzoyl)piperidine-4-carboxylate.
| Compound Name | hexyl 1-(2-chlorobenzoyl)piperidine-4-carboxylate |
|---|---|
| PubChem CID | 91734475 |
| Molecular Formula | C19H26ClNO3 |
| Molecular Weight | 351.87 g/mol |
| Exact Mass | 351.16 |
| IUPAC Name | hexyl 1-(2-chlorobenzoyl)piperidine-4-carboxylate |
| SMILES | CCCCCCOC(=O)C1CCN(C(=O)c2ccccc2Cl)CC1 |
| InChI | InChI=1S/C19H26ClNO3/c1-2-3-4-7-14-24-19(23)15-10-12-21(13-11-15)18(22)16-8-5-6-9-17(16)20/h5-6,8-9,15H,2-4,7,10-14H2,1H3 |
| InChIKey | MLLWMKNCLAFBEY-UHFFFAOYSA-N |
| XLogP | 4.32 |
| TPSA | 46.61 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 351.87 |
| LogP ≤ 5 | 4.32 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|