C22H29F4NO3 — CID 91731427
octyl 1-[2-fluoro-5-(trifluoromethyl)benzoyl]piperidine-4-carboxylate (PubChem CID 91731427) has the molecular formula C22H29F4NO3 and a molecular weight of 431.47 g/mol. Its IUPAC name is octyl 1-[2-fluoro-5-(trifluoromethyl)benzoyl]piperidine-4-carboxylate.
| Compound Name | octyl 1-[2-fluoro-5-(trifluoromethyl)benzoyl]piperidine-4-carboxylate |
|---|---|
| PubChem CID | 91731427 |
| Molecular Formula | C22H29F4NO3 |
| Molecular Weight | 431.47 g/mol |
| Exact Mass | 431.21 |
| IUPAC Name | octyl 1-[2-fluoro-5-(trifluoromethyl)benzoyl]piperidine-4-carboxylate |
| SMILES | CCCCCCCCOC(=O)C1CCN(C(=O)c2cc(C(F)(F)F)ccc2F)CC1 |
| InChI | InChI=1S/C22H29F4NO3/c1-2-3-4-5-6-7-14-30-21(29)16-10-12-27(13-11-16)20(28)18-15-17(22(24,25)26)8-9-19(18)23/h8-9,15-16H,2-7,10-14H2,1H3 |
| InChIKey | YIUIUBCXKQGMMU-UHFFFAOYSA-N |
| XLogP | 5.60 |
| TPSA | 46.61 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 431.47 |
| LogP ≤ 5 | 5.60 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|