C24H34F3NO3 — CID 91726527
decyl 1-[2-(trifluoromethyl)benzoyl]piperidine-4-carboxylate (PubChem CID 91726527) has the molecular formula C24H34F3NO3 and a molecular weight of 441.53 g/mol. Its IUPAC name is decyl 1-[2-(trifluoromethyl)benzoyl]piperidine-4-carboxylate.
| Compound Name | decyl 1-[2-(trifluoromethyl)benzoyl]piperidine-4-carboxylate |
|---|---|
| PubChem CID | 91726527 |
| Molecular Formula | C24H34F3NO3 |
| Molecular Weight | 441.53 g/mol |
| Exact Mass | 441.25 |
| IUPAC Name | decyl 1-[2-(trifluoromethyl)benzoyl]piperidine-4-carboxylate |
| SMILES | CCCCCCCCCCOC(=O)C1CCN(C(=O)c2ccccc2C(F)(F)F)CC1 |
| InChI | InChI=1S/C24H34F3NO3/c1-2-3-4-5-6-7-8-11-18-31-23(30)19-14-16-28(17-15-19)22(29)20-12-9-10-13-21(20)24(25,26)27/h9-10,12-13,19H,2-8,11,14-18H2,1H3 |
| InChIKey | PTQVJPUSVFSEGC-UHFFFAOYSA-N |
| XLogP | 6.24 |
| TPSA | 46.61 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 441.53 |
| LogP ≤ 5 | 6.24 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|