C17H23ClN2O3S — CID 7419657
(2R,4R)-N-butyl-2-(2-chlorophenyl)-3-(2-methoxyacetyl)-1,3-thiazolidine-4-carboxamide (PubChem CID 7419657) has the molecular formula C17H23ClN2O3S and a molecular weight of 370.90 g/mol. Its IUPAC name is (2R,4R)-N-butyl-2-(2-chlorophenyl)-3-(2-methoxyacetyl)-1,3-thiazolidine-4-carboxamide.
| Compound Name | (2R,4R)-N-butyl-2-(2-chlorophenyl)-3-(2-methoxyacetyl)-1,3-thiazolidine-4-carboxamide |
|---|---|
| PubChem CID | 7419657 |
| Molecular Formula | C17H23ClN2O3S |
| Molecular Weight | 370.90 g/mol |
| Exact Mass | 370.11 |
| IUPAC Name | (2R,4R)-N-butyl-2-(2-chlorophenyl)-3-(2-methoxyacetyl)-1,3-thiazolidine-4-carboxamide |
| SMILES | CCCCNC(=O)[C@@H]1CS[C@H](c2ccccc2Cl)N1C(=O)COC |
| InChI | InChI=1S/C17H23ClN2O3S/c1-3-4-9-19-16(22)14-11-24-17(20(14)15(21)10-23-2)12-7-5-6-8-13(12)18/h5-8,14,17H,3-4,9-11H2,1-2H3,(H,19,22)/t14-,17+/m0/s1 |
| InChIKey | NSESGHKEPAGOGT-WMLDXEAASA-N |
| XLogP | 2.85 |
| TPSA | 58.64 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 370.90 |
| LogP ≤ 5 | 2.85 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|