C19H27ClN2O3S — CID 42748221
3-(2-chlorobenzoyl)-N-(3-methoxypropyl)-2-(2-methylpropyl)-1,3-thiazolidine-4-carboxamide (PubChem CID 42748221) has the molecular formula C19H27ClN2O3S and a molecular weight of 398.96 g/mol. Its IUPAC name is 3-(2-chlorobenzoyl)-N-(3-methoxypropyl)-2-(2-methylpropyl)-1,3-thiazolidine-4-carboxamide.
| Compound Name | 3-(2-chlorobenzoyl)-N-(3-methoxypropyl)-2-(2-methylpropyl)-1,3-thiazolidine-4-carboxamide |
|---|---|
| PubChem CID | 42748221 |
| Molecular Formula | C19H27ClN2O3S |
| Molecular Weight | 398.96 g/mol |
| Exact Mass | 398.14 |
| IUPAC Name | 3-(2-chlorobenzoyl)-N-(3-methoxypropyl)-2-(2-methylpropyl)-1,3-thiazolidine-4-carboxamide |
| SMILES | COCCCNC(=O)C1CSC(CC(C)C)N1C(=O)c1ccccc1Cl |
| InChI | InChI=1S/C19H27ClN2O3S/c1-13(2)11-17-22(19(24)14-7-4-5-8-15(14)20)16(12-26-17)18(23)21-9-6-10-25-3/h4-5,7-8,13,16-17H,6,9-12H2,1-3H3,(H,21,23) |
| InChIKey | FCMFODSZBYCDRV-UHFFFAOYSA-N |
| XLogP | 3.42 |
| TPSA | 58.64 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 398.96 |
| LogP ≤ 5 | 3.42 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|