C17H26N2O3S — CID 42744888
N-butyl-3-(furan-2-carbonyl)-2-(2-methylpropyl)-1,3-thiazolidine-4-carboxamide (PubChem CID 42744888) has the molecular formula C17H26N2O3S and a molecular weight of 338.47 g/mol. Its IUPAC name is N-butyl-3-(furan-2-carbonyl)-2-(2-methylpropyl)-1,3-thiazolidine-4-carboxamide.
| Compound Name | N-butyl-3-(furan-2-carbonyl)-2-(2-methylpropyl)-1,3-thiazolidine-4-carboxamide |
|---|---|
| PubChem CID | 42744888 |
| Molecular Formula | C17H26N2O3S |
| Molecular Weight | 338.47 g/mol |
| Exact Mass | 338.17 |
| IUPAC Name | N-butyl-3-(furan-2-carbonyl)-2-(2-methylpropyl)-1,3-thiazolidine-4-carboxamide |
| SMILES | CCCCNC(=O)C1CSC(CC(C)C)N1C(=O)c1ccco1 |
| InChI | InChI=1S/C17H26N2O3S/c1-4-5-8-18-16(20)13-11-23-15(10-12(2)3)19(13)17(21)14-7-6-9-22-14/h6-7,9,12-13,15H,4-5,8,10-11H2,1-3H3,(H,18,20) |
| InChIKey | AFBKIDXLQVLYSG-UHFFFAOYSA-N |
| XLogP | 3.13 |
| TPSA | 62.55 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 338.47 |
| LogP ≤ 5 | 3.13 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|