C28H38N2O6S — CID 3942883
3-(3,4-dimethoxybenzoyl)-N-[2-(3,4-dimethoxyphenyl)ethyl]-2-pentyl-1,3-thiazolidine-4-carboxamide (PubChem CID 3942883) has the molecular formula C28H38N2O6S and a molecular weight of 530.69 g/mol. Its IUPAC name is 3-(3,4-dimethoxybenzoyl)-N-[2-(3,4-dimethoxyphenyl)ethyl]-2-pentyl-1,3-thiazolidine-4-carboxamide.
| Compound Name | 3-(3,4-dimethoxybenzoyl)-N-[2-(3,4-dimethoxyphenyl)ethyl]-2-pentyl-1,3-thiazolidine-4-carboxamide |
|---|---|
| PubChem CID | 3942883 |
| Molecular Formula | C28H38N2O6S |
| Molecular Weight | 530.69 g/mol |
| Exact Mass | 530.25 |
| IUPAC Name | 3-(3,4-dimethoxybenzoyl)-N-[2-(3,4-dimethoxyphenyl)ethyl]-2-pentyl-1,3-thiazolidine-4-carboxamide |
| SMILES | CCCCCC1SCC(C(=O)NCCc2ccc(OC)c(OC)c2)N1C(=O)c1ccc(OC)c(OC)c1 |
| InChI | InChI=1S/C28H38N2O6S/c1-6-7-8-9-26-30(28(32)20-11-13-23(34-3)25(17-20)36-5)21(18-37-26)27(31)29-15-14-19-10-12-22(33-2)24(16-19)35-4/h10-13,16-17,21,26H,6-9,14-15,18H2,1-5H3,(H,29,31) |
| InChIKey | KKORKWKRMXXEGX-UHFFFAOYSA-N |
| XLogP | 4.54 |
| TPSA | 86.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 530.69 |
| LogP ≤ 5 | 4.54 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|