C22H22ClNO3S — CID 3388333
propyl 2-(3-chlorophenyl)-3-(3-phenylprop-2-enoyl)-1,3-thiazolidine-4-carboxylate (PubChem CID 3388333) has the molecular formula C22H22ClNO3S and a molecular weight of 415.94 g/mol. Its IUPAC name is propyl 2-(3-chlorophenyl)-3-(3-phenylprop-2-enoyl)-1,3-thiazolidine-4-carboxylate.
| Compound Name | propyl 2-(3-chlorophenyl)-3-(3-phenylprop-2-enoyl)-1,3-thiazolidine-4-carboxylate |
|---|---|
| PubChem CID | 3388333 |
| Molecular Formula | C22H22ClNO3S |
| Molecular Weight | 415.94 g/mol |
| Exact Mass | 415.10 |
| IUPAC Name | propyl 2-(3-chlorophenyl)-3-(3-phenylprop-2-enoyl)-1,3-thiazolidine-4-carboxylate |
| SMILES | CCCOC(=O)C1CSC(c2cccc(Cl)c2)N1C(=O)C=Cc1ccccc1 |
| InChI | InChI=1S/C22H22ClNO3S/c1-2-13-27-22(26)19-15-28-21(17-9-6-10-18(23)14-17)24(19)20(25)12-11-16-7-4-3-5-8-16/h3-12,14,19,21H,2,13,15H2,1H3 |
| InChIKey | WCQIARRAOBTTAB-UHFFFAOYSA-N |
| XLogP | 4.95 |
| TPSA | 46.61 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 415.94 |
| LogP ≤ 5 | 4.95 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|