C27H25NO5S2 — CID 12812637
(4R)-3-(3-benzoylsulfanylpropanoyl)-2-(3-phenylmethoxyphenyl)-1,3-thiazolidine-4-carboxylic acid (PubChem CID 12812637) has the molecular formula C27H25NO5S2 and a molecular weight of 507.63 g/mol. Its IUPAC name is (4R)-3-(3-benzoylsulfanylpropanoyl)-2-(3-phenylmethoxyphenyl)-1,3-thiazolidine-4-carboxylic acid.
| Compound Name | (4R)-3-(3-benzoylsulfanylpropanoyl)-2-(3-phenylmethoxyphenyl)-1,3-thiazolidine-4-carboxylic acid |
|---|---|
| PubChem CID | 12812637 |
| Molecular Formula | C27H25NO5S2 |
| Molecular Weight | 507.63 g/mol |
| Exact Mass | 507.12 |
| IUPAC Name | (4R)-3-(3-benzoylsulfanylpropanoyl)-2-(3-phenylmethoxyphenyl)-1,3-thiazolidine-4-carboxylic acid |
| SMILES | O=C(SCCC(=O)N1C(c2cccc(OCc3ccccc3)c2)SC[C@H]1C(=O)O)c1ccccc1 |
| InChI | InChI=1S/C27H25NO5S2/c29-24(14-15-34-27(32)20-10-5-2-6-11-20)28-23(26(30)31)18-35-25(28)21-12-7-13-22(16-21)33-17-19-8-3-1-4-9-19/h1-13,16,23,25H,14-15,17-18H2,(H,30,31)/t23-,25?/m0/s1 |
| InChIKey | UADBOSNCZVJPFK-LFQPHHBNSA-N |
| XLogP | 5.26 |
| TPSA | 83.91 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 35 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 507.63 |
| LogP ≤ 5 | 5.26 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'thioester', 'substructure': 'N/A'} |
|---|