C18H19NO2S — CID 7262558
1-[(2R)-2-(3-phenylmethoxyphenyl)-1,3-thiazolidin-3-yl]ethanone (PubChem CID 7262558) has the molecular formula C18H19NO2S and a molecular weight of 313.42 g/mol. Its IUPAC name is 1-[(2R)-2-(3-phenylmethoxyphenyl)-1,3-thiazolidin-3-yl]ethanone.
| Compound Name | 1-[(2R)-2-(3-phenylmethoxyphenyl)-1,3-thiazolidin-3-yl]ethanone |
|---|---|
| PubChem CID | 7262558 |
| Molecular Formula | C18H19NO2S |
| Molecular Weight | 313.42 g/mol |
| Exact Mass | 313.11 |
| IUPAC Name | 1-[(2R)-2-(3-phenylmethoxyphenyl)-1,3-thiazolidin-3-yl]ethanone |
| SMILES | CC(=O)N1CCS[C@@H]1c1cccc(OCc2ccccc2)c1 |
| InChI | InChI=1S/C18H19NO2S/c1-14(20)19-10-11-22-18(19)16-8-5-9-17(12-16)21-13-15-6-3-2-4-7-15/h2-9,12,18H,10-11,13H2,1H3/t18-/m1/s1 |
| InChIKey | FPADEFVAKDAPSH-GOSISDBHSA-N |
| XLogP | 3.86 |
| TPSA | 29.54 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 313.42 |
| LogP ≤ 5 | 3.86 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |