C24H25NO4S2 — CID 3266105
3-(4-ethoxyphenyl)sulfonyl-2-(3-phenylmethoxyphenyl)-1,3-thiazolidine (PubChem CID 3266105) has the molecular formula C24H25NO4S2 and a molecular weight of 455.60 g/mol. Its IUPAC name is 3-(4-ethoxyphenyl)sulfonyl-2-(3-phenylmethoxyphenyl)-1,3-thiazolidine.
| Compound Name | 3-(4-ethoxyphenyl)sulfonyl-2-(3-phenylmethoxyphenyl)-1,3-thiazolidine |
|---|---|
| PubChem CID | 3266105 |
| Molecular Formula | C24H25NO4S2 |
| Molecular Weight | 455.60 g/mol |
| Exact Mass | 455.12 |
| IUPAC Name | 3-(4-ethoxyphenyl)sulfonyl-2-(3-phenylmethoxyphenyl)-1,3-thiazolidine |
| SMILES | CCOc1ccc(S(=O)(=O)N2CCSC2c2cccc(OCc3ccccc3)c2)cc1 |
| InChI | InChI=1S/C24H25NO4S2/c1-2-28-21-11-13-23(14-12-21)31(26,27)25-15-16-30-24(25)20-9-6-10-22(17-20)29-18-19-7-4-3-5-8-19/h3-14,17,24H,2,15-16,18H2,1H3 |
| InChIKey | UECJUBXZUDRDKR-UHFFFAOYSA-N |
| XLogP | 5.10 |
| TPSA | 55.84 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 455.60 |
| LogP ≤ 5 | 5.10 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |