C24H25NO3S2 — CID 4122599
3-(4-ethylphenyl)sulfonyl-2-(4-phenylmethoxyphenyl)-1,3-thiazolidine (PubChem CID 4122599) has the molecular formula C24H25NO3S2 and a molecular weight of 439.60 g/mol. Its IUPAC name is 3-(4-ethylphenyl)sulfonyl-2-(4-phenylmethoxyphenyl)-1,3-thiazolidine.
| Compound Name | 3-(4-ethylphenyl)sulfonyl-2-(4-phenylmethoxyphenyl)-1,3-thiazolidine |
|---|---|
| PubChem CID | 4122599 |
| Molecular Formula | C24H25NO3S2 |
| Molecular Weight | 439.60 g/mol |
| Exact Mass | 439.13 |
| IUPAC Name | 3-(4-ethylphenyl)sulfonyl-2-(4-phenylmethoxyphenyl)-1,3-thiazolidine |
| SMILES | CCc1ccc(S(=O)(=O)N2CCSC2c2ccc(OCc3ccccc3)cc2)cc1 |
| InChI | InChI=1S/C24H25NO3S2/c1-2-19-8-14-23(15-9-19)30(26,27)25-16-17-29-24(25)21-10-12-22(13-11-21)28-18-20-6-4-3-5-7-20/h3-15,24H,2,16-18H2,1H3 |
| InChIKey | JMCGWFPFLLOWMC-UHFFFAOYSA-N |
| XLogP | 5.26 |
| TPSA | 46.61 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 439.60 |
| LogP ≤ 5 | 5.26 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |